C7H10F4N2O3S — CID 171923668
1-ethylimidazole;1,1,2,2-tetrafluoroethanesulfonic acid (PubChem CID 171923668) has the molecular formula C7H10F4N2O3S and a molecular weight of 278.23 g/mol. Its IUPAC name is 1-ethylimidazole;1,1,2,2-tetrafluoroethanesulfonic acid.
| Compound Name | 1-ethylimidazole;1,1,2,2-tetrafluoroethanesulfonic acid |
|---|---|
| PubChem CID | 171923668 |
| Molecular Formula | C7H10F4N2O3S |
| Molecular Weight | 278.23 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | 1-ethylimidazole;1,1,2,2-tetrafluoroethanesulfonic acid |
| SMILES | CCn1ccnc1.O=S(=O)(O)C(F)(F)C(F)F |
| InChI | InChI=1S/C5H8N2.C2H2F4O3S/c1-2-7-4-3-6-5-7;3-1(4)2(5,6)10(7,8)9/h3-5H,2H2,1H3;1H,(H,7,8,9) |
| InChIKey | SRWDBFZMOOIDFX-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.23 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|