C10H12F8N2O3S — CID 87550974
1-propylimidazole;1,1,2,2-tetrafluoroethyl 1,1,2,2-tetrafluoroethanesulfonate (PubChem CID 87550974) has the molecular formula C10H12F8N2O3S and a molecular weight of 392.27 g/mol. Its IUPAC name is 1-propylimidazole;1,1,2,2-tetrafluoroethyl 1,1,2,2-tetrafluoroethanesulfonate.
| Compound Name | 1-propylimidazole;1,1,2,2-tetrafluoroethyl 1,1,2,2-tetrafluoroethanesulfonate |
|---|---|
| PubChem CID | 87550974 |
| Molecular Formula | C10H12F8N2O3S |
| Molecular Weight | 392.27 g/mol |
| Exact Mass | 392.04 |
| IUPAC Name | 1-propylimidazole;1,1,2,2-tetrafluoroethyl 1,1,2,2-tetrafluoroethanesulfonate |
| SMILES | CCCn1ccnc1.O=S(=O)(OC(F)(F)C(F)F)C(F)(F)C(F)F |
| InChI | InChI=1S/C6H10N2.C4H2F8O3S/c1-2-4-8-5-3-7-6-8;5-1(6)3(9,10)15-16(13,14)4(11,12)2(7)8/h3,5-6H,2,4H2,1H3;1-2H |
| InChIKey | IRPLOQUBHOZCBM-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.27 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|