C44H38F3N4O6P — CID 171929680
6'-[ethyl-[3-[4-[1-(2-phosphonatoethyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]propyl]amino]-2'-[3-(trifluoromethyl)anilino]spiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 171929680) has the molecular formula C44H38F3N4O6P and a molecular weight of 806.78 g/mol. Its IUPAC name is 6'-[ethyl-[3-[4-[1-(2-phosphonatoethyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]propyl]amino]-2'-[3-(trifluoromethyl)anilino]spiro[2-benzofuran-3,9'-xanthene]-1-one.
| Compound Name | 6'-[ethyl-[3-[4-[1-(2-phosphonatoethyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]propyl]amino]-2'-[3-(trifluoromethyl)anilino]spiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 171929680 |
| Molecular Formula | C44H38F3N4O6P |
| Molecular Weight | 806.78 g/mol |
| Exact Mass | 806.25 |
| IUPAC Name | 6'-[ethyl-[3-[4-[1-(2-phosphonatoethyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]propyl]amino]-2'-[3-(trifluoromethyl)anilino]spiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | CCN(CCC[n+]1ccc(-c2cc[n+](CCP(=O)([O-])[O-])cc2)cc1)c1ccc2c(c1)Oc1ccc(Nc3cccc(C(F)(F)F)c3)cc1C21OC(=O)c2ccccc21 |
| InChI | InChI=1S/C44H38F3N4O6P/c1-2-51(20-6-19-49-21-15-30(16-22-49)31-17-23-50(24-18-31)25-26-58(53,54)55)35-12-13-38-41(29-35)56-40-14-11-34(48-33-8-5-7-32(27-33)44(45,46)47)28-39(40)43(38)37-10-4-3-9-36(37)42(52)57-43/h3-5,7-18,21-24,27-29,48H,2,6,19-20,25-26H2,1H3 |
| InChIKey | IMXRDXUXPQSENT-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 121.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.78 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|