C25H20N4O6S — CID 171934311
(5Z)-5-(quinoxalin-2-ylmethylidene)-3-[[3-(3,4,5-trimethoxyphenyl)-1,2-oxazol-5-yl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 171934311) has the molecular formula C25H20N4O6S and a molecular weight of 504.52 g/mol. Its IUPAC name is (5Z)-5-(quinoxalin-2-ylmethylidene)-3-[[3-(3,4,5-trimethoxyphenyl)-1,2-oxazol-5-yl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-(quinoxalin-2-ylmethylidene)-3-[[3-(3,4,5-trimethoxyphenyl)-1,2-oxazol-5-yl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 171934311 |
| Molecular Formula | C25H20N4O6S |
| Molecular Weight | 504.52 g/mol |
| Exact Mass | 504.11 |
| IUPAC Name | (5Z)-5-(quinoxalin-2-ylmethylidene)-3-[[3-(3,4,5-trimethoxyphenyl)-1,2-oxazol-5-yl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1cc(-c2cc(CN3C(=O)S/C(=C\c4cnc5ccccc5n4)C3=O)on2)cc(OC)c1OC |
| InChI | InChI=1S/C25H20N4O6S/c1-32-20-8-14(9-21(33-2)23(20)34-3)19-11-16(35-28-19)13-29-24(30)22(36-25(29)31)10-15-12-26-17-6-4-5-7-18(17)27-15/h4-12H,13H2,1-3H3/b22-10- |
| InChIKey | RJGIRQDLJQYZOY-YVNNLAQVSA-N |
| XLogP | 4.55 |
| TPSA | 116.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.52 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|