C13H16N4O — CID 171959694
3-imidazo[1,2-a]pyrimidin-3-yl-8-azabicyclo[3.2.1]octan-3-ol (PubChem CID 171959694) has the molecular formula C13H16N4O and a molecular weight of 244.30 g/mol. Its IUPAC name is 3-imidazo[1,2-a]pyrimidin-3-yl-8-azabicyclo[3.2.1]octan-3-ol.
| Compound Name | 3-imidazo[1,2-a]pyrimidin-3-yl-8-azabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 171959694 |
| Molecular Formula | C13H16N4O |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 3-imidazo[1,2-a]pyrimidin-3-yl-8-azabicyclo[3.2.1]octan-3-ol |
| SMILES | OC1(c2cnc3ncccn23)CC2CCC(C1)N2 |
| InChI | InChI=1S/C13H16N4O/c18-13(6-9-2-3-10(7-13)16-9)11-8-15-12-14-4-1-5-17(11)12/h1,4-5,8-10,16,18H,2-3,6-7H2 |
| InChIKey | LDBWZSURIZABPF-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |