C21H30N2O3 — CID 171975427
(2S,3S)-3-methyl-2-[[(E)-3-(4-methylphenyl)prop-2-enoyl]amino]-N-(oxolan-2-ylmethyl)pentanamide (PubChem CID 171975427) has the molecular formula C21H30N2O3 and a molecular weight of 358.48 g/mol. Its IUPAC name is (2S,3S)-3-methyl-2-[[(E)-3-(4-methylphenyl)prop-2-enoyl]amino]-N-(oxolan-2-ylmethyl)pentanamide.
| Compound Name | (2S,3S)-3-methyl-2-[[(E)-3-(4-methylphenyl)prop-2-enoyl]amino]-N-(oxolan-2-ylmethyl)pentanamide |
|---|---|
| PubChem CID | 171975427 |
| Molecular Formula | C21H30N2O3 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | (2S,3S)-3-methyl-2-[[(E)-3-(4-methylphenyl)prop-2-enoyl]amino]-N-(oxolan-2-ylmethyl)pentanamide |
| SMILES | CC[C@H](C)[C@H](NC(=O)/C=C/c1ccc(C)cc1)C(=O)NCC1CCCO1 |
| InChI | InChI=1S/C21H30N2O3/c1-4-16(3)20(21(25)22-14-18-6-5-13-26-18)23-19(24)12-11-17-9-7-15(2)8-10-17/h7-12,16,18,20H,4-6,13-14H2,1-3H3,(H,22,25)(H,23,24)/b12-11+/t16-,18?,20-/m0/s1 |
| InChIKey | UYIIQDUEGXMUON-JUINJCCMSA-N |
| XLogP | 2.83 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|