C22H18O8S4 — CID 171976324
dimethyl 9-[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]-4a,9a-dihydroindeno[1,2-b][1,4]dithiine-2,3-dicarboxylate (PubChem CID 171976324) has the molecular formula C22H18O8S4 and a molecular weight of 538.65 g/mol. Its IUPAC name is dimethyl 9-[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]-4a,9a-dihydroindeno[1,2-b][1,4]dithiine-2,3-dicarboxylate.
| Compound Name | dimethyl 9-[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]-4a,9a-dihydroindeno[1,2-b][1,4]dithiine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 171976324 |
| Molecular Formula | C22H18O8S4 |
| Molecular Weight | 538.65 g/mol |
| Exact Mass | 537.99 |
| IUPAC Name | dimethyl 9-[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]-4a,9a-dihydroindeno[1,2-b][1,4]dithiine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)SC(=C2c3ccccc3C3SC(C(=O)OC)=C(C(=O)OC)SC23)S1 |
| InChI | InChI=1S/C22H18O8S4/c1-27-18(23)14-15(19(24)28-2)32-13-11(9-7-5-6-8-10(9)12(13)31-14)22-33-16(20(25)29-3)17(34-22)21(26)30-4/h5-8,12-13H,1-4H3 |
| InChIKey | XKYBVMXDNFRORD-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.65 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|