C15H25N2O7S- — CID 171979608
N-[3-[ethyl-[2-hydroxy-3-(4-methoxyphenoxy)propyl]amino]-2-hydroxypropyl]sulfamate (PubChem CID 171979608) has the molecular formula C15H25N2O7S- and a molecular weight of 377.44 g/mol. Its IUPAC name is N-[3-[ethyl-[2-hydroxy-3-(4-methoxyphenoxy)propyl]amino]-2-hydroxypropyl]sulfamate.
| Compound Name | N-[3-[ethyl-[2-hydroxy-3-(4-methoxyphenoxy)propyl]amino]-2-hydroxypropyl]sulfamate |
|---|---|
| PubChem CID | 171979608 |
| Molecular Formula | C15H25N2O7S- |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | N-[3-[ethyl-[2-hydroxy-3-(4-methoxyphenoxy)propyl]amino]-2-hydroxypropyl]sulfamate |
| SMILES | CCN(CC(O)CNS(=O)(=O)[O-])CC(O)COc1ccc(OC)cc1 |
| InChI | InChI=1S/C15H26N2O7S/c1-3-17(9-12(18)8-16-25(20,21)22)10-13(19)11-24-15-6-4-14(23-2)5-7-15/h4-7,12-13,16,18-19H,3,8-11H2,1-2H3,(H,20,21,22)/p-1 |
| InChIKey | JYDOBVUDFIBQAA-UHFFFAOYSA-M |
| XLogP | -0.83 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|