C15H13N5O5 — CID 171982788
(E)-N-[2-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)diazenyl]-2-oxoethyl]-3-phenylprop-2-enamide (PubChem CID 171982788) has the molecular formula C15H13N5O5 and a molecular weight of 343.30 g/mol. Its IUPAC name is (E)-N-[2-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)diazenyl]-2-oxoethyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[2-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)diazenyl]-2-oxoethyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 171982788 |
| Molecular Formula | C15H13N5O5 |
| Molecular Weight | 343.30 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | (E)-N-[2-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)diazenyl]-2-oxoethyl]-3-phenylprop-2-enamide |
| SMILES | O=C(CNC(=O)/C=C/c1ccccc1)/N=N/c1c(O)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C15H13N5O5/c21-10(7-6-9-4-2-1-3-5-9)16-8-11(22)19-20-12-13(23)17-15(25)18-14(12)24/h1-7H,8H2,(H,16,21)(H3,17,18,23,24,25)/b7-6+,20-19+ |
| InChIKey | NXGZMAGNZQSFEQ-ZWSRXQOGSA-N |
| XLogP | 0.21 |
| TPSA | 156.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.30 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|