C17H18Cl2N2O — CID 171983124
(6,8-dichloro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl)-pyrrolidin-1-ylmethanone (PubChem CID 171983124) has the molecular formula C17H18Cl2N2O and a molecular weight of 337.25 g/mol. Its IUPAC name is (6,8-dichloro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl)-pyrrolidin-1-ylmethanone.
| Compound Name | (6,8-dichloro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl)-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 171983124 |
| Molecular Formula | C17H18Cl2N2O |
| Molecular Weight | 337.25 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | (6,8-dichloro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl)-pyrrolidin-1-ylmethanone |
| SMILES | O=C(C1Nc2c(Cl)cc(Cl)cc2C2C=CCC12)N1CCCC1 |
| InChI | InChI=1S/C17H18Cl2N2O/c18-10-8-13-11-4-3-5-12(11)16(20-15(13)14(19)9-10)17(22)21-6-1-2-7-21/h3-4,8-9,11-12,16,20H,1-2,5-7H2 |
| InChIKey | XDOKAOLWOSDJSM-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.25 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|