C16H10BrN3O4S — CID 171983375
(2Z)-2-[(5-bromo-2-hydroxy-3-nitrophenyl)methylidene]-3a,4-dihydro-[1,3]thiazolo[3,2-a]benzimidazol-1-one (PubChem CID 171983375) has the molecular formula C16H10BrN3O4S and a molecular weight of 420.24 g/mol. Its IUPAC name is (2Z)-2-[(5-bromo-2-hydroxy-3-nitrophenyl)methylidene]-3a,4-dihydro-[1,3]thiazolo[3,2-a]benzimidazol-1-one.
| Compound Name | (2Z)-2-[(5-bromo-2-hydroxy-3-nitrophenyl)methylidene]-3a,4-dihydro-[1,3]thiazolo[3,2-a]benzimidazol-1-one |
|---|---|
| PubChem CID | 171983375 |
| Molecular Formula | C16H10BrN3O4S |
| Molecular Weight | 420.24 g/mol |
| Exact Mass | 418.96 |
| IUPAC Name | (2Z)-2-[(5-bromo-2-hydroxy-3-nitrophenyl)methylidene]-3a,4-dihydro-[1,3]thiazolo[3,2-a]benzimidazol-1-one |
| SMILES | O=C1/C(=C/c2cc(Br)cc([N+](=O)[O-])c2O)SC2Nc3ccccc3N12 |
| InChI | InChI=1S/C16H10BrN3O4S/c17-9-5-8(14(21)12(7-9)20(23)24)6-13-15(22)19-11-4-2-1-3-10(11)18-16(19)25-13/h1-7,16,18,21H/b13-6- |
| InChIKey | IOYZZUWOPKTOJZ-MLPAPPSSSA-N |
| XLogP | 3.89 |
| TPSA | 95.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.24 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|