C8H8AsBrN4O3 — CID 89145528
2-[(5-bromo-2-hydroxy-3-nitrophenyl)methylidenearsanyl]guanidine (PubChem CID 89145528) has the molecular formula C8H8AsBrN4O3 and a molecular weight of 363.00 g/mol. Its IUPAC name is 2-[(5-bromo-2-hydroxy-3-nitrophenyl)methylidenearsanyl]guanidine.
| Compound Name | 2-[(5-bromo-2-hydroxy-3-nitrophenyl)methylidenearsanyl]guanidine |
|---|---|
| PubChem CID | 89145528 |
| Molecular Formula | C8H8AsBrN4O3 |
| Molecular Weight | 363.00 g/mol |
| Exact Mass | 361.90 |
| IUPAC Name | 2-[(5-bromo-2-hydroxy-3-nitrophenyl)methylidenearsanyl]guanidine |
| SMILES | NC(N)=N/[As]=C/c1cc(Br)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C8H8AsBrN4O3/c10-5-1-4(3-9-13-8(11)12)7(15)6(2-5)14(16)17/h1-3,15H,(H4,11,12,13) |
| InChIKey | IOIADJHEJYLFSN-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 127.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.00 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|