C23H19ClN2O3S — CID 171986052
(4-chlorophenyl)-[3-(4-methylphenyl)sulfonyl-2-phenylimidazol-4-yl]methanol (PubChem CID 171986052) has the molecular formula C23H19ClN2O3S and a molecular weight of 438.94 g/mol. Its IUPAC name is (4-chlorophenyl)-[3-(4-methylphenyl)sulfonyl-2-phenylimidazol-4-yl]methanol.
| Compound Name | (4-chlorophenyl)-[3-(4-methylphenyl)sulfonyl-2-phenylimidazol-4-yl]methanol |
|---|---|
| PubChem CID | 171986052 |
| Molecular Formula | C23H19ClN2O3S |
| Molecular Weight | 438.94 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | (4-chlorophenyl)-[3-(4-methylphenyl)sulfonyl-2-phenylimidazol-4-yl]methanol |
| SMILES | Cc1ccc(S(=O)(=O)n2c(C(O)c3ccc(Cl)cc3)cnc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H19ClN2O3S/c1-16-7-13-20(14-8-16)30(28,29)26-21(22(27)17-9-11-19(24)12-10-17)15-25-23(26)18-5-3-2-4-6-18/h2-15,22,27H,1H3 |
| InChIKey | CXLSEMIRMAXJLV-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.94 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |