C28H21Cl2NO3S — CID 102308221
5,5-bis(4-chlorophenyl)-2-(4-methylphenyl)sulfonyl-3-phenyl-1,2-oxazole (PubChem CID 102308221) has the molecular formula C28H21Cl2NO3S and a molecular weight of 522.45 g/mol. Its IUPAC name is 5,5-bis(4-chlorophenyl)-2-(4-methylphenyl)sulfonyl-3-phenyl-1,2-oxazole.
| Compound Name | 5,5-bis(4-chlorophenyl)-2-(4-methylphenyl)sulfonyl-3-phenyl-1,2-oxazole |
|---|---|
| PubChem CID | 102308221 |
| Molecular Formula | C28H21Cl2NO3S |
| Molecular Weight | 522.45 g/mol |
| Exact Mass | 521.06 |
| IUPAC Name | 5,5-bis(4-chlorophenyl)-2-(4-methylphenyl)sulfonyl-3-phenyl-1,2-oxazole |
| SMILES | Cc1ccc(S(=O)(=O)N2OC(c3ccc(Cl)cc3)(c3ccc(Cl)cc3)C=C2c2ccccc2)cc1 |
| InChI | InChI=1S/C28H21Cl2NO3S/c1-20-7-17-26(18-8-20)35(32,33)31-27(21-5-3-2-4-6-21)19-28(34-31,22-9-13-24(29)14-10-22)23-11-15-25(30)16-12-23/h2-19H,1H3 |
| InChIKey | AXANBNNFDOTNIW-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.45 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |