C36H29Cl2NO4S — CID 132602625
2,2-bis(4-chlorophenyl)-6,7-dimethoxy-1-(4-methylphenyl)sulfonyl-4-phenylquinoline (PubChem CID 132602625) has the molecular formula C36H29Cl2NO4S and a molecular weight of 642.60 g/mol. Its IUPAC name is 2,2-bis(4-chlorophenyl)-6,7-dimethoxy-1-(4-methylphenyl)sulfonyl-4-phenylquinoline.
| Compound Name | 2,2-bis(4-chlorophenyl)-6,7-dimethoxy-1-(4-methylphenyl)sulfonyl-4-phenylquinoline |
|---|---|
| PubChem CID | 132602625 |
| Molecular Formula | C36H29Cl2NO4S |
| Molecular Weight | 642.60 g/mol |
| Exact Mass | 641.12 |
| IUPAC Name | 2,2-bis(4-chlorophenyl)-6,7-dimethoxy-1-(4-methylphenyl)sulfonyl-4-phenylquinoline |
| SMILES | COc1cc2c(cc1OC)N(S(=O)(=O)c1ccc(C)cc1)C(c1ccc(Cl)cc1)(c1ccc(Cl)cc1)C=C2c1ccccc1 |
| InChI | InChI=1S/C36H29Cl2NO4S/c1-24-9-19-30(20-10-24)44(40,41)39-33-22-35(43-3)34(42-2)21-31(33)32(25-7-5-4-6-8-25)23-36(39,26-11-15-28(37)16-12-26)27-13-17-29(38)18-14-27/h4-23H,1-3H3 |
| InChIKey | OIYODSZTHVGLIH-UHFFFAOYSA-N |
| XLogP | 8.90 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.60 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |