C25H19NO5 — CID 17201862
[4-[(1,3-dioxoinden-2-ylidene)methyl]-2-ethoxyphenyl] N-phenylcarbamate (PubChem CID 17201862) has the molecular formula C25H19NO5 and a molecular weight of 413.43 g/mol. Its IUPAC name is [4-[(1,3-dioxoinden-2-ylidene)methyl]-2-ethoxyphenyl] N-phenylcarbamate.
| Compound Name | [4-[(1,3-dioxoinden-2-ylidene)methyl]-2-ethoxyphenyl] N-phenylcarbamate |
|---|---|
| PubChem CID | 17201862 |
| Molecular Formula | C25H19NO5 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | [4-[(1,3-dioxoinden-2-ylidene)methyl]-2-ethoxyphenyl] N-phenylcarbamate |
| SMILES | CCOc1cc(C=C2C(=O)c3ccccc3C2=O)ccc1OC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C25H19NO5/c1-2-30-22-15-16(14-20-23(27)18-10-6-7-11-19(18)24(20)28)12-13-21(22)31-25(29)26-17-8-4-3-5-9-17/h3-15H,2H2,1H3,(H,26,29) |
| InChIKey | BXUKFDZZLAGCQC-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|