C27H26N2O3 — CID 17236798
4-(2,4-dihydroxyphenyl)-N-(3,4-dimethylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxamide (PubChem CID 17236798) has the molecular formula C27H26N2O3 and a molecular weight of 426.52 g/mol. Its IUPAC name is 4-(2,4-dihydroxyphenyl)-N-(3,4-dimethylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxamide.
| Compound Name | 4-(2,4-dihydroxyphenyl)-N-(3,4-dimethylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxamide |
|---|---|
| PubChem CID | 17236798 |
| Molecular Formula | C27H26N2O3 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | 4-(2,4-dihydroxyphenyl)-N-(3,4-dimethylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2cccc3c2NC(c2ccc(O)cc2O)C2CC=CC32)cc1C |
| InChI | InChI=1S/C27H26N2O3/c1-15-9-10-17(13-16(15)2)28-27(32)23-8-4-7-21-19-5-3-6-20(19)25(29-26(21)23)22-12-11-18(30)14-24(22)31/h3-5,7-14,19-20,25,29-31H,6H2,1-2H3,(H,28,32) |
| InChIKey | QZSPLLMPNHONRE-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|