C16H12Cl2N2O4S2 — CID 17247618
1-(benzenesulfonyl)-N-(3,4-dichlorophenyl)pyrrole-3-sulfonamide (PubChem CID 17247618) has the molecular formula C16H12Cl2N2O4S2 and a molecular weight of 431.32 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N-(3,4-dichlorophenyl)pyrrole-3-sulfonamide.
| Compound Name | 1-(benzenesulfonyl)-N-(3,4-dichlorophenyl)pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 17247618 |
| Molecular Formula | C16H12Cl2N2O4S2 |
| Molecular Weight | 431.32 g/mol |
| Exact Mass | 429.96 |
| IUPAC Name | 1-(benzenesulfonyl)-N-(3,4-dichlorophenyl)pyrrole-3-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(Cl)c(Cl)c1)c1ccn(S(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C16H12Cl2N2O4S2/c17-15-7-6-12(10-16(15)18)19-25(21,22)14-8-9-20(11-14)26(23,24)13-4-2-1-3-5-13/h1-11,19H |
| InChIKey | HTPUCRWGVJKPNK-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 85.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.32 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |