C47H32N4O — CID 172507565
4-[4-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]phenyl]-1,3-diphenylbenzimidazol-2-one (PubChem CID 172507565) has the molecular formula C47H32N4O and a molecular weight of 668.80 g/mol. Its IUPAC name is 4-[4-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]phenyl]-1,3-diphenylbenzimidazol-2-one.
| Compound Name | 4-[4-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]phenyl]-1,3-diphenylbenzimidazol-2-one |
|---|---|
| PubChem CID | 172507565 |
| Molecular Formula | C47H32N4O |
| Molecular Weight | 668.80 g/mol |
| Exact Mass | 668.26 |
| IUPAC Name | 4-[4-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]phenyl]-1,3-diphenylbenzimidazol-2-one |
| SMILES | O=c1n(-c2ccccc2)c2cccc(-c3ccc(-c4ccc(-c5cc(-c6ccccc6)nc(-c6ccccc6)n5)cc4)cc3)c2n1-c1ccccc1 |
| InChI | InChI=1S/C47H32N4O/c52-47-50(39-18-9-3-10-19-39)44-23-13-22-41(45(44)51(47)40-20-11-4-12-21-40)35-28-24-33(25-29-35)34-26-30-37(31-27-34)43-32-42(36-14-5-1-6-15-36)48-46(49-43)38-16-7-2-8-17-38/h1-32H |
| InChIKey | XSZKVEZHDQKEIS-UHFFFAOYSA-N |
| XLogP | 10.91 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.80 |
| LogP ≤ 5 | 10.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |