About CID 172514256
CID 172514256 (PubChem CID 172514256) has the molecular formula C56H44N10Pt2-2
and a molecular weight of 1247.19 g/mol.
Molecular Properties
| Compound Name | CID 172514256 |
| PubChem CID | 172514256 |
| Molecular Formula | C56H44N10Pt2-2 |
| Molecular Weight | 1247.19 g/mol |
| Exact Mass | 1246.31 |
| IUPAC Name | — |
| SMILES | CN1[CH-]N(c2[c-]cccc2)c2ccccc21.CN1[CH-]N(c2[c-]cccc2)c2ccccc21.[Pt+4].[Pt].[c-]1[n-]c(-c2ccccc2)n[n+]1-c1ccccc1.c1ccc(-c2n[n-]c(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/2C14H10N3.2C14H12N2.2Pt/c1-3-7-12(8-4-1)14-15-11-17(16-14)13-9-5-2-6-10-13;1-3-7-11(8-4-1)13-15-14(17-16-13)12-9-5-2-6-10-12;2*1-15-11-16(12-7-3-2-4-8-12)14-10-6-5-9-13(14)15;;/h2*1-10H;2*2-7,9-11H,1H3;;/q2*-1;2*-2;;+4 |
| InChIKey | SEGXOZYQGIKZBF-UHFFFAOYSA-N |
| XLogP | 10.93 |
| TPSA | 83.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 68 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1247.19 |
| LogP ≤ 5 | 10.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze CID 172514256 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 172514256?
The IUPAC name of CID 172514256 (CID 172514256) is not available.
What is the SMILES notation for CID 172514256?
The canonical SMILES for CID 172514256 is CN1[CH-]N(c2[c-]cccc2)c2ccccc21.CN1[CH-]N(c2[c-]cccc2)c2ccccc21.[Pt+4].[Pt].[c-]1[n-]c(-c2ccccc2)n[n+]1-c1ccccc1.c1ccc(-c2n[n-]c(-c3ccccc3)n2)cc1.
What is the InChIKey of CID 172514256?
The InChIKey is SEGXOZYQGIKZBF-UHFFFAOYSA-N. The full InChI is InChI=1S/2C14H10N3.2C14H12N2.2Pt/c1-3-7-12(8-4-1)14-15-11-17(16-14)13-9-5-2-6-10-13;1-3-7-11(8-4-1)13-15-14(17-16-13)12-9-5-2-6-10-12;2*1-15-11-16(12-7-3-2-4-8-12)14-10-6-5-9-13(14)15;;/h2*1-10H;2*2-7,9-11H,1H3;;/q2*-1;2*-2;;+4.
What are the key properties of CID 172514256?
CID 172514256 has a molecular weight of 1247.19 g/mol, XLogP of 10.93, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 172514256 is sourced from PubChem (CID 172514256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).