C56H44N10Pt2-2 — CID 172514256
CID 172514256 (PubChem CID 172514256) has the molecular formula C56H44N10Pt2-2 and a molecular weight of 1247.19 g/mol.
| Compound Name | CID 172514256 |
|---|---|
| PubChem CID | 172514256 |
| Molecular Formula | C56H44N10Pt2-2 |
| Molecular Weight | 1247.19 g/mol |
| Exact Mass | 1246.31 |
| IUPAC Name | — |
| SMILES | CN1[CH-]N(c2[c-]cccc2)c2ccccc21.CN1[CH-]N(c2[c-]cccc2)c2ccccc21.[Pt+4].[Pt].[c-]1[n-]c(-c2ccccc2)n[n+]1-c1ccccc1.c1ccc(-c2n[n-]c(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/2C14H10N3.2C14H12N2.2Pt/c1-3-7-12(8-4-1)14-15-11-17(16-14)13-9-5-2-6-10-13;1-3-7-11(8-4-1)13-15-14(17-16-13)12-9-5-2-6-10-12;2*1-15-11-16(12-7-3-2-4-8-12)14-10-6-5-9-13(14)15;;/h2*1-10H;2*2-7,9-11H,1H3;;/q2*-1;2*-2;;+4 |
| InChIKey | SEGXOZYQGIKZBF-UHFFFAOYSA-N |
| XLogP | 10.93 |
| TPSA | 83.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1247.19 |
| LogP ≤ 5 | 10.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|