About 1-butoxyethyl 2-[2-(chloromethoxy)ethoxy]-5-iodobenzoate
1-butoxyethyl 2-[2-(chloromethoxy)ethoxy]-5-iodobenzoate (PubChem CID 172518223) has the molecular formula C16H22ClIO5
and a molecular weight of 456.70 g/mol. Its IUPAC name is 1-butoxyethyl 2-[2-(chloromethoxy)ethoxy]-5-iodobenzoate.
Molecular Properties
| Compound Name | 1-butoxyethyl 2-[2-(chloromethoxy)ethoxy]-5-iodobenzoate |
| PubChem CID | 172518223 |
| Molecular Formula | C16H22ClIO5 |
| Molecular Weight | 456.70 g/mol |
| Exact Mass | 456.02 |
| IUPAC Name | 1-butoxyethyl 2-[2-(chloromethoxy)ethoxy]-5-iodobenzoate |
| SMILES | CCCCOC(C)OC(=O)c1cc(I)ccc1OCCOCCl |
| InChI | InChI=1S/C16H22ClIO5/c1-3-4-7-21-12(2)23-16(19)14-10-13(18)5-6-15(14)22-9-8-20-11-17/h5-6,10,12H,3-4,7-9,11H2,1-2H3 |
| InChIKey | UCWZLPMUCVDECT-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 456.70 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-butoxyethyl 2-[2-(chloromethoxy)ethoxy]-5-iodobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butoxyethyl 2-[2-(chloromethoxy)ethoxy]-5-iodobenzoate?
The IUPAC name of 1-butoxyethyl 2-[2-(chloromethoxy)ethoxy]-5-iodobenzoate (CID 172518223) is 1-butoxyethyl 2-[2-(chloromethoxy)ethoxy]-5-iodobenzoate.
What is the SMILES notation for 1-butoxyethyl 2-[2-(chloromethoxy)ethoxy]-5-iodobenzoate?
The canonical SMILES for 1-butoxyethyl 2-[2-(chloromethoxy)ethoxy]-5-iodobenzoate is CCCCOC(C)OC(=O)c1cc(I)ccc1OCCOCCl.
What is the InChIKey of 1-butoxyethyl 2-[2-(chloromethoxy)ethoxy]-5-iodobenzoate?
The InChIKey is UCWZLPMUCVDECT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22ClIO5/c1-3-4-7-21-12(2)23-16(19)14-10-13(18)5-6-15(14)22-9-8-20-11-17/h5-6,10,12H,3-4,7-9,11H2,1-2H3.
What are the key properties of 1-butoxyethyl 2-[2-(chloromethoxy)ethoxy]-5-iodobenzoate?
1-butoxyethyl 2-[2-(chloromethoxy)ethoxy]-5-iodobenzoate has a molecular weight of 456.70 g/mol, XLogP of 4.20, 11 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butoxyethyl 2-[2-(chloromethoxy)ethoxy]-5-iodobenzoate is sourced from PubChem (CID 172518223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).