C18H26NO6P — CID 172548468
[(3aS,7aS)-3a-(3,4-dimethoxyphenyl)-1,7a-dimethyl-2,3,4,5-tetrahydroindol-6-yl] dihydrogen phosphate (PubChem CID 172548468) has the molecular formula C18H26NO6P and a molecular weight of 383.38 g/mol. Its IUPAC name is [(3aS,7aS)-3a-(3,4-dimethoxyphenyl)-1,7a-dimethyl-2,3,4,5-tetrahydroindol-6-yl] dihydrogen phosphate.
| Compound Name | [(3aS,7aS)-3a-(3,4-dimethoxyphenyl)-1,7a-dimethyl-2,3,4,5-tetrahydroindol-6-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 172548468 |
| Molecular Formula | C18H26NO6P |
| Molecular Weight | 383.38 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | [(3aS,7aS)-3a-(3,4-dimethoxyphenyl)-1,7a-dimethyl-2,3,4,5-tetrahydroindol-6-yl] dihydrogen phosphate |
| SMILES | COc1ccc([C@@]23CCC(OP(=O)(O)O)=C[C@]2(C)N(C)CC3)cc1OC |
| InChI | InChI=1S/C18H26NO6P/c1-17-12-14(25-26(20,21)22)7-8-18(17,9-10-19(17)2)13-5-6-15(23-3)16(11-13)24-4/h5-6,11-12H,7-10H2,1-4H3,(H2,20,21,22)/t17-,18-/m0/s1 |
| InChIKey | IOGAHWRPJVUUDP-ROUUACIJSA-N |
| XLogP | 2.82 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|