C20H14F3NO2 — CID 172554055
3-(2-cyclopropylethynyl)-3-(4-hydroxyphenyl)-7-(trifluoromethyl)-1H-indol-2-one (PubChem CID 172554055) has the molecular formula C20H14F3NO2 and a molecular weight of 357.33 g/mol. Its IUPAC name is 3-(2-cyclopropylethynyl)-3-(4-hydroxyphenyl)-7-(trifluoromethyl)-1H-indol-2-one.
| Compound Name | 3-(2-cyclopropylethynyl)-3-(4-hydroxyphenyl)-7-(trifluoromethyl)-1H-indol-2-one |
|---|---|
| PubChem CID | 172554055 |
| Molecular Formula | C20H14F3NO2 |
| Molecular Weight | 357.33 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 3-(2-cyclopropylethynyl)-3-(4-hydroxyphenyl)-7-(trifluoromethyl)-1H-indol-2-one |
| SMILES | O=C1Nc2c(C(F)(F)F)cccc2C1(C#CC1CC1)c1ccc(O)cc1 |
| InChI | InChI=1S/C20H14F3NO2/c21-20(22,23)16-3-1-2-15-17(16)24-18(26)19(15,11-10-12-4-5-12)13-6-8-14(25)9-7-13/h1-3,6-9,12,25H,4-5H2,(H,24,26) |
| InChIKey | SMAZNZICKKNMPW-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.33 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|