C21H15F7N2O3 — CID 178162018
[4-[2-oxo-3-(3,3,4,4-tetrafluoropyrrolidin-1-yl)-7-(trifluoromethyl)-1H-indol-3-yl]phenyl] acetate (PubChem CID 178162018) has the molecular formula C21H15F7N2O3 and a molecular weight of 476.35 g/mol. Its IUPAC name is [4-[2-oxo-3-(3,3,4,4-tetrafluoropyrrolidin-1-yl)-7-(trifluoromethyl)-1H-indol-3-yl]phenyl] acetate.
| Compound Name | [4-[2-oxo-3-(3,3,4,4-tetrafluoropyrrolidin-1-yl)-7-(trifluoromethyl)-1H-indol-3-yl]phenyl] acetate |
|---|---|
| PubChem CID | 178162018 |
| Molecular Formula | C21H15F7N2O3 |
| Molecular Weight | 476.35 g/mol |
| Exact Mass | 476.10 |
| IUPAC Name | [4-[2-oxo-3-(3,3,4,4-tetrafluoropyrrolidin-1-yl)-7-(trifluoromethyl)-1H-indol-3-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C2(N3CC(F)(F)C(F)(F)C3)C(=O)Nc3c(C(F)(F)F)cccc32)cc1 |
| InChI | InChI=1S/C21H15F7N2O3/c1-11(31)33-13-7-5-12(6-8-13)20(30-9-18(22,23)19(24,25)10-30)14-3-2-4-15(21(26,27)28)16(14)29-17(20)32/h2-8H,9-10H2,1H3,(H,29,32) |
| InChIKey | HTHBEUYQYJGSKY-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.35 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|