C18H14F4N2O2 — CID 178162009
3-(4-hydroxyphenyl)-3-(3,3,4,4-tetrafluoropyrrolidin-1-yl)-1H-indol-2-one (PubChem CID 178162009) has the molecular formula C18H14F4N2O2 and a molecular weight of 366.31 g/mol. Its IUPAC name is 3-(4-hydroxyphenyl)-3-(3,3,4,4-tetrafluoropyrrolidin-1-yl)-1H-indol-2-one.
| Compound Name | 3-(4-hydroxyphenyl)-3-(3,3,4,4-tetrafluoropyrrolidin-1-yl)-1H-indol-2-one |
|---|---|
| PubChem CID | 178162009 |
| Molecular Formula | C18H14F4N2O2 |
| Molecular Weight | 366.31 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 3-(4-hydroxyphenyl)-3-(3,3,4,4-tetrafluoropyrrolidin-1-yl)-1H-indol-2-one |
| SMILES | O=C1Nc2ccccc2C1(c1ccc(O)cc1)N1CC(F)(F)C(F)(F)C1 |
| InChI | InChI=1S/C18H14F4N2O2/c19-16(20)9-24(10-17(16,21)22)18(11-5-7-12(25)8-6-11)13-3-1-2-4-14(13)23-15(18)26/h1-8,25H,9-10H2,(H,23,26) |
| InChIKey | DTIQWIAGPNYAFT-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.31 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|