C12H22N2 — CID 172555806
4-ethyl-1,2,3,3a,4,5,5a,6,7,8,8a,8b-dodecahydropyrrolo[3,2-e]indole (PubChem CID 172555806) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is 4-ethyl-1,2,3,3a,4,5,5a,6,7,8,8a,8b-dodecahydropyrrolo[3,2-e]indole.
| Compound Name | 4-ethyl-1,2,3,3a,4,5,5a,6,7,8,8a,8b-dodecahydropyrrolo[3,2-e]indole |
|---|---|
| PubChem CID | 172555806 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | 4-ethyl-1,2,3,3a,4,5,5a,6,7,8,8a,8b-dodecahydropyrrolo[3,2-e]indole |
| SMILES | CCC1CC2NCCC2C2CCNC12 |
| InChI | InChI=1S/C12H22N2/c1-2-8-7-11-9(3-5-13-11)10-4-6-14-12(8)10/h8-14H,2-7H2,1H3 |
| InChIKey | LYSXVZMFVBUOLG-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |