C8H19N2O- — CID 172556046
N,N,N'-triethyl-N'-oxidoethane-1,2-diamine (PubChem CID 172556046) has the molecular formula C8H19N2O- and a molecular weight of 159.25 g/mol. Its IUPAC name is N,N,N'-triethyl-N'-oxidoethane-1,2-diamine.
| Compound Name | N,N,N'-triethyl-N'-oxidoethane-1,2-diamine |
|---|---|
| PubChem CID | 172556046 |
| Molecular Formula | C8H19N2O- |
| Molecular Weight | 159.25 g/mol |
| Exact Mass | 159.15 |
| IUPAC Name | N,N,N'-triethyl-N'-oxidoethane-1,2-diamine |
| SMILES | CCN([O-])CCN(CC)CC |
| InChI | InChI=1S/C8H19N2O/c1-4-9(5-2)7-8-10(11)6-3/h4-8H2,1-3H3/q-1 |
| InChIKey | QGAMBXGYIHUBRO-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.25 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|