C21H26N2O3Si — CID 172562700
2-[[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-pyridinyl]methyl]isoindole-1,3-dione (PubChem CID 172562700) has the molecular formula C21H26N2O3Si and a molecular weight of 382.54 g/mol. Its IUPAC name is 2-[[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-pyridinyl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-pyridinyl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 172562700 |
| Molecular Formula | C21H26N2O3Si |
| Molecular Weight | 382.54 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | 2-[[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-pyridinyl]methyl]isoindole-1,3-dione |
| SMILES | CC(C)(C)[Si](C)(C)OCc1cncc(CN2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C21H26N2O3Si/c1-21(2,3)27(4,5)26-14-16-10-15(11-22-12-16)13-23-19(24)17-8-6-7-9-18(17)20(23)25/h6-12H,13-14H2,1-5H3 |
| InChIKey | NALRDNBTEAPHSH-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.54 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|