C18H28ClN5O3 — CID 172568965
N-[1-(5-chloro-7-morpholin-4-ylimidazo[4,5-b]pyridin-3-yl)-3-methoxypropan-2-yl]-N-methylformamide;ethane (PubChem CID 172568965) has the molecular formula C18H28ClN5O3 and a molecular weight of 397.91 g/mol. Its IUPAC name is N-[1-(5-chloro-7-morpholin-4-ylimidazo[4,5-b]pyridin-3-yl)-3-methoxypropan-2-yl]-N-methylformamide;ethane.
| Compound Name | N-[1-(5-chloro-7-morpholin-4-ylimidazo[4,5-b]pyridin-3-yl)-3-methoxypropan-2-yl]-N-methylformamide;ethane |
|---|---|
| PubChem CID | 172568965 |
| Molecular Formula | C18H28ClN5O3 |
| Molecular Weight | 397.91 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | N-[1-(5-chloro-7-morpholin-4-ylimidazo[4,5-b]pyridin-3-yl)-3-methoxypropan-2-yl]-N-methylformamide;ethane |
| SMILES | CC.COCC(Cn1cnc2c(N3CCOCC3)cc(Cl)nc21)N(C)C=O |
| InChI | InChI=1S/C16H22ClN5O3.C2H6/c1-20(11-23)12(9-24-2)8-22-10-18-15-13(7-14(17)19-16(15)22)21-3-5-25-6-4-21;1-2/h7,10-12H,3-6,8-9H2,1-2H3;1-2H3 |
| InChIKey | VWYJPZBPHHWURF-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 72.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.91 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|