C27H28F2N6S — CID 172569693
2,5-difluoro-3-[1-(4-piperazin-1-ylphenyl)-3-pyridin-4-ylpyrazol-4-yl]-N-propylsulfanylaniline (PubChem CID 172569693) has the molecular formula C27H28F2N6S and a molecular weight of 506.63 g/mol. Its IUPAC name is 2,5-difluoro-3-[1-(4-piperazin-1-ylphenyl)-3-pyridin-4-ylpyrazol-4-yl]-N-propylsulfanylaniline.
| Compound Name | 2,5-difluoro-3-[1-(4-piperazin-1-ylphenyl)-3-pyridin-4-ylpyrazol-4-yl]-N-propylsulfanylaniline |
|---|---|
| PubChem CID | 172569693 |
| Molecular Formula | C27H28F2N6S |
| Molecular Weight | 506.63 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | 2,5-difluoro-3-[1-(4-piperazin-1-ylphenyl)-3-pyridin-4-ylpyrazol-4-yl]-N-propylsulfanylaniline |
| SMILES | CCCSNc1cc(F)cc(-c2cn(-c3ccc(N4CCNCC4)cc3)nc2-c2ccncc2)c1F |
| InChI | InChI=1S/C27H28F2N6S/c1-2-15-36-33-25-17-20(28)16-23(26(25)29)24-18-35(32-27(24)19-7-9-30-10-8-19)22-5-3-21(4-6-22)34-13-11-31-12-14-34/h3-10,16-18,31,33H,2,11-15H2,1H3 |
| InChIKey | AYLYJLNSXSADBJ-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 58.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.63 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|