C28H28ClF2N7S — CID 172569885
5-chloro-2-fluoro-3-[1-(2-fluoro-4-piperazin-1-ylphenyl)-3-pyridin-4-ylpyrazol-4-yl]-N-pyrrolidin-1-ylsulfanylaniline (PubChem CID 172569885) has the molecular formula C28H28ClF2N7S and a molecular weight of 568.10 g/mol. Its IUPAC name is 5-chloro-2-fluoro-3-[1-(2-fluoro-4-piperazin-1-ylphenyl)-3-pyridin-4-ylpyrazol-4-yl]-N-pyrrolidin-1-ylsulfanylaniline.
| Compound Name | 5-chloro-2-fluoro-3-[1-(2-fluoro-4-piperazin-1-ylphenyl)-3-pyridin-4-ylpyrazol-4-yl]-N-pyrrolidin-1-ylsulfanylaniline |
|---|---|
| PubChem CID | 172569885 |
| Molecular Formula | C28H28ClF2N7S |
| Molecular Weight | 568.10 g/mol |
| Exact Mass | 567.18 |
| IUPAC Name | 5-chloro-2-fluoro-3-[1-(2-fluoro-4-piperazin-1-ylphenyl)-3-pyridin-4-ylpyrazol-4-yl]-N-pyrrolidin-1-ylsulfanylaniline |
| SMILES | Fc1cc(N2CCNCC2)ccc1-n1cc(-c2cc(Cl)cc(NSN3CCCC3)c2F)c(-c2ccncc2)n1 |
| InChI | InChI=1S/C28H28ClF2N7S/c29-20-15-22(27(31)25(16-20)35-39-37-11-1-2-12-37)23-18-38(34-28(23)19-5-7-32-8-6-19)26-4-3-21(17-24(26)30)36-13-9-33-10-14-36/h3-8,15-18,33,35H,1-2,9-14H2 |
| InChIKey | VPRBVCCVMJBTKY-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 61.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.10 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|