C28H29FN6OS — CID 172570497
[4-[4-[2-fluoro-3-(propylsulfanylamino)phenyl]-3-pyridin-4-ylpyrazol-1-yl]phenyl]-piperazin-1-ylmethanone (PubChem CID 172570497) has the molecular formula C28H29FN6OS and a molecular weight of 516.65 g/mol. Its IUPAC name is [4-[4-[2-fluoro-3-(propylsulfanylamino)phenyl]-3-pyridin-4-ylpyrazol-1-yl]phenyl]-piperazin-1-ylmethanone.
| Compound Name | [4-[4-[2-fluoro-3-(propylsulfanylamino)phenyl]-3-pyridin-4-ylpyrazol-1-yl]phenyl]-piperazin-1-ylmethanone |
|---|---|
| PubChem CID | 172570497 |
| Molecular Formula | C28H29FN6OS |
| Molecular Weight | 516.65 g/mol |
| Exact Mass | 516.21 |
| IUPAC Name | [4-[4-[2-fluoro-3-(propylsulfanylamino)phenyl]-3-pyridin-4-ylpyrazol-1-yl]phenyl]-piperazin-1-ylmethanone |
| SMILES | CCCSNc1cccc(-c2cn(-c3ccc(C(=O)N4CCNCC4)cc3)nc2-c2ccncc2)c1F |
| InChI | InChI=1S/C28H29FN6OS/c1-2-18-37-33-25-5-3-4-23(26(25)29)24-19-35(32-27(24)20-10-12-30-13-11-20)22-8-6-21(7-9-22)28(36)34-16-14-31-15-17-34/h3-13,19,31,33H,2,14-18H2,1H3 |
| InChIKey | KIEOPLZHQHBSQC-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.65 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|