C29H30F5N7O2S — CID 172570210
N-[ethyl(methyl)amino]sulfanyl-2,5-difluoro-3-[1-(4-piperazin-1-ylphenyl)-3-pyridin-4-ylpyrazol-4-yl]aniline;2,2,2-trifluoroacetic acid (PubChem CID 172570210) has the molecular formula C29H30F5N7O2S and a molecular weight of 635.66 g/mol. Its IUPAC name is N-[ethyl(methyl)amino]sulfanyl-2,5-difluoro-3-[1-(4-piperazin-1-ylphenyl)-3-pyridin-4-ylpyrazol-4-yl]aniline;2,2,2-trifluoroacetic acid.
| Compound Name | N-[ethyl(methyl)amino]sulfanyl-2,5-difluoro-3-[1-(4-piperazin-1-ylphenyl)-3-pyridin-4-ylpyrazol-4-yl]aniline;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 172570210 |
| Molecular Formula | C29H30F5N7O2S |
| Molecular Weight | 635.66 g/mol |
| Exact Mass | 635.21 |
| IUPAC Name | N-[ethyl(methyl)amino]sulfanyl-2,5-difluoro-3-[1-(4-piperazin-1-ylphenyl)-3-pyridin-4-ylpyrazol-4-yl]aniline;2,2,2-trifluoroacetic acid |
| SMILES | CCN(C)SNc1cc(F)cc(-c2cn(-c3ccc(N4CCNCC4)cc3)nc2-c2ccncc2)c1F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C27H29F2N7S.C2HF3O2/c1-3-34(2)37-33-25-17-20(28)16-23(26(25)29)24-18-36(32-27(24)19-8-10-30-11-9-19)22-6-4-21(5-7-22)35-14-12-31-13-15-35;3-2(4,5)1(6)7/h4-11,16-18,31,33H,3,12-15H2,1-2H3;(H,6,7) |
| InChIKey | KLSJAYLQFKDKIP-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 98.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.66 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|