C29H30ClFN6S — CID 172570381
5-chloro-N-cyclopentylsulfanyl-2-fluoro-3-[1-(4-piperazin-1-ylphenyl)-3-pyridin-4-ylpyrazol-4-yl]aniline (PubChem CID 172570381) has the molecular formula C29H30ClFN6S and a molecular weight of 549.12 g/mol. Its IUPAC name is 5-chloro-N-cyclopentylsulfanyl-2-fluoro-3-[1-(4-piperazin-1-ylphenyl)-3-pyridin-4-ylpyrazol-4-yl]aniline.
| Compound Name | 5-chloro-N-cyclopentylsulfanyl-2-fluoro-3-[1-(4-piperazin-1-ylphenyl)-3-pyridin-4-ylpyrazol-4-yl]aniline |
|---|---|
| PubChem CID | 172570381 |
| Molecular Formula | C29H30ClFN6S |
| Molecular Weight | 549.12 g/mol |
| Exact Mass | 548.19 |
| IUPAC Name | 5-chloro-N-cyclopentylsulfanyl-2-fluoro-3-[1-(4-piperazin-1-ylphenyl)-3-pyridin-4-ylpyrazol-4-yl]aniline |
| SMILES | Fc1c(NSC2CCCC2)cc(Cl)cc1-c1cn(-c2ccc(N3CCNCC3)cc2)nc1-c1ccncc1 |
| InChI | InChI=1S/C29H30ClFN6S/c30-21-17-25(28(31)27(18-21)35-38-24-3-1-2-4-24)26-19-37(34-29(26)20-9-11-32-12-10-20)23-7-5-22(6-8-23)36-15-13-33-14-16-36/h5-12,17-19,24,33,35H,1-4,13-16H2 |
| InChIKey | RFAOOKAOMKFUOP-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 58.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.12 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|