C12H19N — CID 172570621
ethane;6-prop-1-en-2-ylcyclohepta-1,3,5-trien-1-amine (PubChem CID 172570621) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is ethane;6-prop-1-en-2-ylcyclohepta-1,3,5-trien-1-amine.
| Compound Name | ethane;6-prop-1-en-2-ylcyclohepta-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 172570621 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | ethane;6-prop-1-en-2-ylcyclohepta-1,3,5-trien-1-amine |
| SMILES | C=C(C)C1=CC=CC=C(N)C1.CC |
| InChI | InChI=1S/C10H13N.C2H6/c1-8(2)9-5-3-4-6-10(11)7-9;1-2/h3-6H,1,7,11H2,2H3;1-2H3 |
| InChIKey | FATDYYXUZHIUJX-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |