C25H49N3O4 — CID 172570693
amino-[4-[[4-(ethoxycarbonylamino)cyclohexyl]methyl]cyclohexyl]carbamic acid;3-methylbut-1-ene;propane (PubChem CID 172570693) has the molecular formula C25H49N3O4 and a molecular weight of 455.68 g/mol. Its IUPAC name is amino-[4-[[4-(ethoxycarbonylamino)cyclohexyl]methyl]cyclohexyl]carbamic acid;3-methylbut-1-ene;propane.
| Compound Name | amino-[4-[[4-(ethoxycarbonylamino)cyclohexyl]methyl]cyclohexyl]carbamic acid;3-methylbut-1-ene;propane |
|---|---|
| PubChem CID | 172570693 |
| Molecular Formula | C25H49N3O4 |
| Molecular Weight | 455.68 g/mol |
| Exact Mass | 455.37 |
| IUPAC Name | amino-[4-[[4-(ethoxycarbonylamino)cyclohexyl]methyl]cyclohexyl]carbamic acid;3-methylbut-1-ene;propane |
| SMILES | C=CC(C)C.CCC.CCOC(=O)NC1CCC(CC2CCC(N(N)C(=O)O)CC2)CC1 |
| InChI | InChI=1S/C17H31N3O4.C5H10.C3H8/c1-2-24-16(21)19-14-7-3-12(4-8-14)11-13-5-9-15(10-6-13)20(18)17(22)23;1-4-5(2)3;1-3-2/h12-15H,2-11,18H2,1H3,(H,19,21)(H,22,23);4-5H,1H2,2-3H3;3H2,1-2H3 |
| InChIKey | MYJIQRUIRCDMES-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.68 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|