C11H14F3N3O — CID 172576564
6-(difluoromethyl)-2-fluoro-4-propan-2-yloxy-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine (PubChem CID 172576564) has the molecular formula C11H14F3N3O and a molecular weight of 261.25 g/mol. Its IUPAC name is 6-(difluoromethyl)-2-fluoro-4-propan-2-yloxy-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine.
| Compound Name | 6-(difluoromethyl)-2-fluoro-4-propan-2-yloxy-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 172576564 |
| Molecular Formula | C11H14F3N3O |
| Molecular Weight | 261.25 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 6-(difluoromethyl)-2-fluoro-4-propan-2-yloxy-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine |
| SMILES | CC(C)Oc1nc(F)nc2c1CN(C(F)F)CC2 |
| InChI | InChI=1S/C11H14F3N3O/c1-6(2)18-9-7-5-17(10(12)13)4-3-8(7)15-11(14)16-9/h6,10H,3-5H2,1-2H3 |
| InChIKey | QITLJWSOVIXOIF-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.25 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|