About ethane;N-methoxy-N-methylacetamide;N-methyl-1,3-thiazol-2-amine
ethane;N-methoxy-N-methylacetamide;N-methyl-1,3-thiazol-2-amine (PubChem CID 172580384) has the molecular formula C10H21N3O2S
and a molecular weight of 247.36 g/mol. Its IUPAC name is ethane;N-methoxy-N-methylacetamide;N-methyl-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | ethane;N-methoxy-N-methylacetamide;N-methyl-1,3-thiazol-2-amine |
| PubChem CID | 172580384 |
| Molecular Formula | C10H21N3O2S |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | ethane;N-methoxy-N-methylacetamide;N-methyl-1,3-thiazol-2-amine |
| SMILES | CC.CNc1nccs1.CON(C)C(C)=O |
| InChI | InChI=1S/C4H6N2S.C4H9NO2.C2H6/c1-5-4-6-2-3-7-4;1-4(6)5(2)7-3;1-2/h2-3H,1H3,(H,5,6);1-3H3;1-2H3 |
| InChIKey | URMLGEVLCUMZLU-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-methoxy-N-methylacetamide;N-methyl-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-methoxy-N-methylacetamide;N-methyl-1,3-thiazol-2-amine?
The IUPAC name of ethane;N-methoxy-N-methylacetamide;N-methyl-1,3-thiazol-2-amine (CID 172580384) is ethane;N-methoxy-N-methylacetamide;N-methyl-1,3-thiazol-2-amine.
What is the SMILES notation for ethane;N-methoxy-N-methylacetamide;N-methyl-1,3-thiazol-2-amine?
The canonical SMILES for ethane;N-methoxy-N-methylacetamide;N-methyl-1,3-thiazol-2-amine is CC.CNc1nccs1.CON(C)C(C)=O.
What is the InChIKey of ethane;N-methoxy-N-methylacetamide;N-methyl-1,3-thiazol-2-amine?
The InChIKey is URMLGEVLCUMZLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N2S.C4H9NO2.C2H6/c1-5-4-6-2-3-7-4;1-4(6)5(2)7-3;1-2/h2-3H,1H3,(H,5,6);1-3H3;1-2H3.
What are the key properties of ethane;N-methoxy-N-methylacetamide;N-methyl-1,3-thiazol-2-amine?
ethane;N-methoxy-N-methylacetamide;N-methyl-1,3-thiazol-2-amine has a molecular weight of 247.36 g/mol, XLogP of 2.24, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-methoxy-N-methylacetamide;N-methyl-1,3-thiazol-2-amine is sourced from PubChem (CID 172580384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).