C15H15F3N2O5S2 — CID 172583450
ethyl 3-amino-4-cyclobutyl-6-(trifluoromethylsulfonyloxy)thieno[2,3-b]pyridine-2-carboxylate (PubChem CID 172583450) has the molecular formula C15H15F3N2O5S2 and a molecular weight of 424.42 g/mol. Its IUPAC name is ethyl 3-amino-4-cyclobutyl-6-(trifluoromethylsulfonyloxy)thieno[2,3-b]pyridine-2-carboxylate.
| Compound Name | ethyl 3-amino-4-cyclobutyl-6-(trifluoromethylsulfonyloxy)thieno[2,3-b]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 172583450 |
| Molecular Formula | C15H15F3N2O5S2 |
| Molecular Weight | 424.42 g/mol |
| Exact Mass | 424.04 |
| IUPAC Name | ethyl 3-amino-4-cyclobutyl-6-(trifluoromethylsulfonyloxy)thieno[2,3-b]pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1sc2nc(OS(=O)(=O)C(F)(F)F)cc(C3CCC3)c2c1N |
| InChI | InChI=1S/C15H15F3N2O5S2/c1-2-24-14(21)12-11(19)10-8(7-4-3-5-7)6-9(20-13(10)26-12)25-27(22,23)15(16,17)18/h6-7H,2-5,19H2,1H3 |
| InChIKey | QHELAYXGAGFCAJ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 108.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.42 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|