C33H28ClN5O3S — CID 172588189
10-[6-chloro-5-cyclopropyl-1-(oxan-2-yl)indazol-4-yl]-5-methylsulfanyl-3-phenylmethoxy-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-one (PubChem CID 172588189) has the molecular formula C33H28ClN5O3S and a molecular weight of 610.14 g/mol. Its IUPAC name is 10-[6-chloro-5-cyclopropyl-1-(oxan-2-yl)indazol-4-yl]-5-methylsulfanyl-3-phenylmethoxy-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-one.
| Compound Name | 10-[6-chloro-5-cyclopropyl-1-(oxan-2-yl)indazol-4-yl]-5-methylsulfanyl-3-phenylmethoxy-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-one |
|---|---|
| PubChem CID | 172588189 |
| Molecular Formula | C33H28ClN5O3S |
| Molecular Weight | 610.14 g/mol |
| Exact Mass | 609.16 |
| IUPAC Name | 10-[6-chloro-5-cyclopropyl-1-(oxan-2-yl)indazol-4-yl]-5-methylsulfanyl-3-phenylmethoxy-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-one |
| SMILES | CSc1nc(OCc2ccccc2)c2c(n1)C(=O)c1c-2ccnc1-c1c(C2CC2)c(Cl)cc2c1cnn2C1CCCCO1 |
| InChI | InChI=1S/C33H28ClN5O3S/c1-43-33-37-30-28(32(38-33)42-17-18-7-3-2-4-8-18)20-12-13-35-29(27(20)31(30)40)26-21-16-36-39(24-9-5-6-14-41-24)23(21)15-22(34)25(26)19-10-11-19/h2-4,7-8,12-13,15-16,19,24H,5-6,9-11,14,17H2,1H3 |
| InChIKey | XAGIQUBBGHWYNQ-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 92.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.14 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |