C28H43InO — CID 172594905
CID 172594905 (PubChem CID 172594905) has the molecular formula C28H43InO and a molecular weight of 510.47 g/mol.
| Compound Name | CID 172594905 |
|---|---|
| PubChem CID | 172594905 |
| Molecular Formula | C28H43InO |
| Molecular Weight | 510.47 g/mol |
| Exact Mass | 510.24 |
| IUPAC Name | — |
| SMILES | CC(C)=CCC/C(C)=C/CCC(C)CCCC1(C)CCc2c(C)c([In])cc(C)c2O1 |
| InChI | InChI=1S/C28H43O.In/c1-21(2)11-8-12-22(3)13-9-14-23(4)15-10-19-28(7)20-18-26-24(5)16-17-25(6)27(26)29-28;/h11,13,17,23H,8-10,12,14-15,18-20H2,1-7H3;/b22-13+; |
| InChIKey | NWETUHLYAWTJNT-PNAHYYPNSA-N |
| XLogP | 7.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.47 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|