C19H26F3N5O4 — CID 172598633
tert-butyl (NE)-N-[[4-[[5-nitro-4-(2,2,2-trifluoroethylamino)-2-pyridinyl]amino]cyclohexyl]methylidene]carbamate (PubChem CID 172598633) has the molecular formula C19H26F3N5O4 and a molecular weight of 445.44 g/mol. Its IUPAC name is tert-butyl (NE)-N-[[4-[[5-nitro-4-(2,2,2-trifluoroethylamino)-2-pyridinyl]amino]cyclohexyl]methylidene]carbamate.
| Compound Name | tert-butyl (NE)-N-[[4-[[5-nitro-4-(2,2,2-trifluoroethylamino)-2-pyridinyl]amino]cyclohexyl]methylidene]carbamate |
|---|---|
| PubChem CID | 172598633 |
| Molecular Formula | C19H26F3N5O4 |
| Molecular Weight | 445.44 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | tert-butyl (NE)-N-[[4-[[5-nitro-4-(2,2,2-trifluoroethylamino)-2-pyridinyl]amino]cyclohexyl]methylidene]carbamate |
| SMILES | CC(C)(C)OC(=O)/N=C/C1CCC(Nc2cc(NCC(F)(F)F)c([N+](=O)[O-])cn2)CC1 |
| InChI | InChI=1S/C19H26F3N5O4/c1-18(2,3)31-17(28)24-9-12-4-6-13(7-5-12)26-16-8-14(25-11-19(20,21)22)15(10-23-16)27(29)30/h8-10,12-13H,4-7,11H2,1-3H3,(H2,23,25,26)/b24-9+ |
| InChIKey | QYFKWSZGSCXRCU-PGGKNCGUSA-N |
| XLogP | 4.94 |
| TPSA | 118.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.44 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|