C23H30F3N5O5 — CID 143804204
tert-butyl pyrrolidine-1-carboxylate;2-N-methyl-5-nitro-4-N-[[2-(trifluoromethoxy)phenyl]methyl]pyridine-2,4-diamine (PubChem CID 143804204) has the molecular formula C23H30F3N5O5 and a molecular weight of 513.52 g/mol. Its IUPAC name is tert-butyl pyrrolidine-1-carboxylate;2-N-methyl-5-nitro-4-N-[[2-(trifluoromethoxy)phenyl]methyl]pyridine-2,4-diamine.
| Compound Name | tert-butyl pyrrolidine-1-carboxylate;2-N-methyl-5-nitro-4-N-[[2-(trifluoromethoxy)phenyl]methyl]pyridine-2,4-diamine |
|---|---|
| PubChem CID | 143804204 |
| Molecular Formula | C23H30F3N5O5 |
| Molecular Weight | 513.52 g/mol |
| Exact Mass | 513.22 |
| IUPAC Name | tert-butyl pyrrolidine-1-carboxylate;2-N-methyl-5-nitro-4-N-[[2-(trifluoromethoxy)phenyl]methyl]pyridine-2,4-diamine |
| SMILES | CC(C)(C)OC(=O)N1CCCC1.CNc1cc(NCc2ccccc2OC(F)(F)F)c([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C14H13F3N4O3.C9H17NO2/c1-18-13-6-10(11(8-20-13)21(22)23)19-7-9-4-2-3-5-12(9)24-14(15,16)17;1-9(2,3)12-8(11)10-6-4-5-7-10/h2-6,8H,7H2,1H3,(H2,18,19,20);4-7H2,1-3H3 |
| InChIKey | LUYLSKUGCNFXAE-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 118.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.52 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|