C27H42N8O3 — CID 172601344
tert-butyl 4-[4-[[[2,5-diamino-6-(butylamino)pyrimidin-4-yl]methylideneamino]methyl]-3-methoxyphenyl]-1,4-diazepane-1-carboxylate (PubChem CID 172601344) has the molecular formula C27H42N8O3 and a molecular weight of 526.69 g/mol. Its IUPAC name is tert-butyl 4-[4-[[[2,5-diamino-6-(butylamino)pyrimidin-4-yl]methylideneamino]methyl]-3-methoxyphenyl]-1,4-diazepane-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[[[2,5-diamino-6-(butylamino)pyrimidin-4-yl]methylideneamino]methyl]-3-methoxyphenyl]-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 172601344 |
| Molecular Formula | C27H42N8O3 |
| Molecular Weight | 526.69 g/mol |
| Exact Mass | 526.34 |
| IUPAC Name | tert-butyl 4-[4-[[[2,5-diamino-6-(butylamino)pyrimidin-4-yl]methylideneamino]methyl]-3-methoxyphenyl]-1,4-diazepane-1-carboxylate |
| SMILES | CCCCNc1nc(N)nc(/C=N/Cc2ccc(N3CCCN(C(=O)OC(C)(C)C)CC3)cc2OC)c1N |
| InChI | InChI=1S/C27H42N8O3/c1-6-7-11-31-24-23(28)21(32-25(29)33-24)18-30-17-19-9-10-20(16-22(19)37-5)34-12-8-13-35(15-14-34)26(36)38-27(2,3)4/h9-10,16,18H,6-8,11-15,17,28H2,1-5H3,(H3,29,31,32,33)/b30-18+ |
| InChIKey | SGCIHYPMWDVSKL-UXHLAJHPSA-N |
| XLogP | 3.93 |
| TPSA | 144.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.69 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|