C18H23N3O3 — CID 172603649
3-(spiro[3,4-dihydrochromene-2,4'-piperidine]-7-ylamino)piperidine-2,6-dione (PubChem CID 172603649) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is 3-(spiro[3,4-dihydrochromene-2,4'-piperidine]-7-ylamino)piperidine-2,6-dione.
| Compound Name | 3-(spiro[3,4-dihydrochromene-2,4'-piperidine]-7-ylamino)piperidine-2,6-dione |
|---|---|
| PubChem CID | 172603649 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 3-(spiro[3,4-dihydrochromene-2,4'-piperidine]-7-ylamino)piperidine-2,6-dione |
| SMILES | O=C1CCC(Nc2ccc3c(c2)OC2(CCNCC2)CC3)C(=O)N1 |
| InChI | InChI=1S/C18H23N3O3/c22-16-4-3-14(17(23)21-16)20-13-2-1-12-5-6-18(24-15(12)11-13)7-9-19-10-8-18/h1-2,11,14,19-20H,3-10H2,(H,21,22,23) |
| InChIKey | LZOKPHBJVDWZTN-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|