C17H14ClFN4 — CID 172608605
2-chloro-6-cyclopropyl-4-[4-fluoro-2-(2-methyl-1,2,4-triazol-3-yl)phenyl]pyridine (PubChem CID 172608605) has the molecular formula C17H14ClFN4 and a molecular weight of 328.78 g/mol. Its IUPAC name is 2-chloro-6-cyclopropyl-4-[4-fluoro-2-(2-methyl-1,2,4-triazol-3-yl)phenyl]pyridine.
| Compound Name | 2-chloro-6-cyclopropyl-4-[4-fluoro-2-(2-methyl-1,2,4-triazol-3-yl)phenyl]pyridine |
|---|---|
| PubChem CID | 172608605 |
| Molecular Formula | C17H14ClFN4 |
| Molecular Weight | 328.78 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 2-chloro-6-cyclopropyl-4-[4-fluoro-2-(2-methyl-1,2,4-triazol-3-yl)phenyl]pyridine |
| SMILES | Cn1ncnc1-c1cc(F)ccc1-c1cc(Cl)nc(C2CC2)c1 |
| InChI | InChI=1S/C17H14ClFN4/c1-23-17(20-9-21-23)14-8-12(19)4-5-13(14)11-6-15(10-2-3-10)22-16(18)7-11/h4-10H,2-3H2,1H3 |
| InChIKey | BSVROXWBYSCQDE-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.78 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|