C30H24N6O4S — CID 172611055
2-(2,4-dioxo-1,3-diazinan-1-yl)-5-[[4-(6-phenylthieno[2,3-d]pyrimidin-4-yl)-3,6-dihydro-2H-pyridin-1-yl]methyl]isoindole-1,3-dione (PubChem CID 172611055) has the molecular formula C30H24N6O4S and a molecular weight of 564.63 g/mol. Its IUPAC name is 2-(2,4-dioxo-1,3-diazinan-1-yl)-5-[[4-(6-phenylthieno[2,3-d]pyrimidin-4-yl)-3,6-dihydro-2H-pyridin-1-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-(2,4-dioxo-1,3-diazinan-1-yl)-5-[[4-(6-phenylthieno[2,3-d]pyrimidin-4-yl)-3,6-dihydro-2H-pyridin-1-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 172611055 |
| Molecular Formula | C30H24N6O4S |
| Molecular Weight | 564.63 g/mol |
| Exact Mass | 564.16 |
| IUPAC Name | 2-(2,4-dioxo-1,3-diazinan-1-yl)-5-[[4-(6-phenylthieno[2,3-d]pyrimidin-4-yl)-3,6-dihydro-2H-pyridin-1-yl]methyl]isoindole-1,3-dione |
| SMILES | O=C1CCN(N2C(=O)c3ccc(CN4CC=C(c5ncnc6sc(-c7ccccc7)cc56)CC4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C30H24N6O4S/c37-25-10-13-35(30(40)33-25)36-28(38)21-7-6-18(14-22(21)29(36)39)16-34-11-8-20(9-12-34)26-23-15-24(19-4-2-1-3-5-19)41-27(23)32-17-31-26/h1-8,14-15,17H,9-13,16H2,(H,33,37,40) |
| InChIKey | NDLRPBMRWWQTQW-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.63 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|