C8H10N2O — CID 172614778
1,2-bis(ethenyl)-4-methoxyimidazole (PubChem CID 172614778) has the molecular formula C8H10N2O and a molecular weight of 150.18 g/mol. Its IUPAC name is 1,2-bis(ethenyl)-4-methoxyimidazole.
| Compound Name | 1,2-bis(ethenyl)-4-methoxyimidazole |
|---|---|
| PubChem CID | 172614778 |
| Molecular Formula | C8H10N2O |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.08 |
| IUPAC Name | 1,2-bis(ethenyl)-4-methoxyimidazole |
| SMILES | C=Cc1nc(OC)cn1C=C |
| InChI | InChI=1S/C8H10N2O/c1-4-7-9-8(11-3)6-10(7)5-2/h4-6H,1-2H2,3H3 |
| InChIKey | DHHUFHNRYNZPHT-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |