C10H13F2N5O — CID 172615445
6-amino-N-(4,4-difluorocyclohexyl)-1,2,4-triazine-5-carboxamide (PubChem CID 172615445) has the molecular formula C10H13F2N5O and a molecular weight of 257.24 g/mol. Its IUPAC name is 6-amino-N-(4,4-difluorocyclohexyl)-1,2,4-triazine-5-carboxamide.
| Compound Name | 6-amino-N-(4,4-difluorocyclohexyl)-1,2,4-triazine-5-carboxamide |
|---|---|
| PubChem CID | 172615445 |
| Molecular Formula | C10H13F2N5O |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 6-amino-N-(4,4-difluorocyclohexyl)-1,2,4-triazine-5-carboxamide |
| SMILES | Nc1nncnc1C(=O)NC1CCC(F)(F)CC1 |
| InChI | InChI=1S/C10H13F2N5O/c11-10(12)3-1-6(2-4-10)16-9(18)7-8(13)17-15-5-14-7/h5-6H,1-4H2,(H2,13,17)(H,16,18) |
| InChIKey | OZRMNZBBPHHXRV-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.24 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |