C11H19BrN4O2 — CID 172615789
tert-butyl N-[1-(5-bromo-2-methyltriazol-4-yl)ethyl]-N-(trideuteriomethyl)carbamate (PubChem CID 172615789) has the molecular formula C11H19BrN4O2 and a molecular weight of 322.22 g/mol. Its IUPAC name is tert-butyl N-[1-(5-bromo-2-methyltriazol-4-yl)ethyl]-N-(trideuteriomethyl)carbamate.
| Compound Name | tert-butyl N-[1-(5-bromo-2-methyltriazol-4-yl)ethyl]-N-(trideuteriomethyl)carbamate |
|---|---|
| PubChem CID | 172615789 |
| Molecular Formula | C11H19BrN4O2 |
| Molecular Weight | 322.22 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | tert-butyl N-[1-(5-bromo-2-methyltriazol-4-yl)ethyl]-N-(trideuteriomethyl)carbamate |
| SMILES | [2H]C([2H])([2H])N(C(=O)OC(C)(C)C)C(C)c1nn(C)nc1Br |
| InChI | InChI=1S/C11H19BrN4O2/c1-7(8-9(12)14-16(6)13-8)15(5)10(17)18-11(2,3)4/h7H,1-6H3/i5D3 |
| InChIKey | NXTUIKNYNNYHEC-VPYROQPTSA-N |
| XLogP | 2.51 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.22 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |